Dataset Viewer
Auto-converted to Parquet Duplicate
messages
listlengths
2
294
metadata
dict
[ { "role": "user", "content": "What is the SMILES notation for <IUPAC> (3R,4R)-N-benzyl-4-(2-methoxyphenyl)-1-(4-methylbenzoyl)pyrrolidine-3-carboxamide </IUPAC> ?" }, { "role": "assistant", "content": "It's <SMILES> COC1=CC=CC=C1C1CN(C(=O)C2=CC=C(C)C=C2)CC1C(=O)NCC1=CC=CC=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Predict a possible product from the listed reactants and reagents. <SMILES> CC(=O)O.COC1=CC=CC(C(C)=O)=C1.C[Si](C)(C)N[Si](C)(C)C.N#CCC#N </SMILES>" }, { "role": "assistant", "content": "<SMILES> COC1=CC=CC(C(C)=C(C#N)C#N)=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Identify possible reactants that could have been used to create the specified product. <SMILES> COCCCOC(=O)N1CCC(C2=NC(C3=CC=C4C(=C3)C(C)(C)CCC4(C)C)=CS2)CC1 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CC1(C)CCC(C)(C)C2=CC(C3=CSC(C4CCNCC4)=N3)=CC=C21.CN(C)C=O.COCCCO </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you identify the reactant(s) that might result in the given product <SMILES> O=S(=O)(C1=CC=CC=C1)N1C=C(C2=COC=C2)C2=CC(C3=CC=CS3)=CN=C21 </SMILES> ?" }, { "role": "assistant", "content": "<SMILES> CCCC[Sn](CCCC)(CCCC)C1=CC=CS1.O=S(=O)(C1=CC=CC=C1)N1C=C(C2=COC=C2)C2=CC(Br)=CN=C21 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Convert the SMILES representation of a molecule <SMILES> O=C(CNS(=O)(=O)C1=CC=CS1)NC1=CC=C(OC(F)(F)F)C=C1 </SMILES> into IUPAC name." }, { "role": "assistant", "content": "<IUPAC> 2-(thiophen-2-ylsulfonylamino)-N-[4-(trifluoromethoxy)phenyl]acetamide </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Predict a possible product from the listed reactants and reagents. <SMILES> CC1=CC(C2CC2)=CN=C1N1CCNCC1.COC(=O)C1=CC=C(CN2CCCS2(=O)=O)N=C1 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CC1=CC(C2CC2)=CN=C1N1CCN(C(=O)C2=CC=C(CN3CCCS3(=O)=O)N=C2)CC1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you tell me the SMILES representation for the molecule <IUPAC> (1Z)-N-(dibenzofuran-3-ylamino)-2,2-dimethylpropanimidoyl cyanide </IUPAC> ?" }, { "role": "assistant", "content": "Sure. <SMILES> CC(C)(C)C(C#N)=NNC1=CC=C2C(=C1)OC1=CC=CC=C12 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <SMILES> CC(Cl)OC(=O)N1CCS(=O)(=O)CC1 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CC(Cl)OC(=O)Cl.O=S1(=O)CCNCC1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you list the reactants that might result in the chemical product <SMILES> O=[N+]([O-])C1=CC([N+](=O)[O-])=C(NC2=NC(Cl)=CC=C2C(F)(F)F)C(C(F)(F)F)=C1 </SMILES> ?" }, { "role": "assistant", "content": "<SMILES> NC1=NC(Cl)=CC=C1C(F)(F)F.O=[N+]([O-])C1=CC([N+](=O)[O-])=C(Cl)C(C(F)(F)F)=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Please provide a feasible product that could be formed using these reactants and reagents: <SMILES> C1CCOC1.CC(=O)O.CC(=O)O[BH-](OC(C)=O)OC(C)=O.CC(Cl)Cl.COCCOC1=CC=C2C(=C1)NC1=C(C(N)=O)N=CC(C3=CC=CC(N)=C3C)=C12.O=CC1=CC=C(F)C=C1C(=O)O.[Na+] </SMILES> ." }, { "role": "assistant", "content": "<SMILES> COCCOC1=CC=C2C(=C1)NC1=C(C(N)=O)N=CC(C3=CC=CC(NCC4=CC=C(F)C=C4C(=O)O)=C3C)=C12 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> C1=CC=C([PH](C2=CC=CC=C2)(C2=CC=CC=C2)[Pd]([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)[PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1.CC#N.CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)NC2=CN=C3C(=C2)C(I)=CN3S(=O)(=O)C2=CC=CC=C2)=C1F.O.O=C([O-])[O-].OB(O)C1=CC=C(F)C(F)=C1.[K+] </SMILES> Considering the given starting materials, what might be the resulting product in a chemical reaction?" }, { "role": "assistant", "content": "<SMILES> CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)NC2=CN=C3NC=C(C4=CC=C(F)C(F)=C4)C3=C2)=C1F </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What is the SMILES representation for <IUPAC> N-[3-(8-azabicyclo[3.2.1]oct-2-en-8-yl)-3-oxopropyl]-2-fluorobenzenesulfonamide </IUPAC> ?" }, { "role": "assistant", "content": "<SMILES> O=C(CCNS(=O)(=O)C1=CC=CC=C1F)N1C2C=CCC1CC2 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> C1=CC=C([PH](C2=CC=CC=C2)(C2=CC=CC=C2)[Pd]([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)[PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1.C1COCCO1.CC(C)(C)OC(=O)N1CCC(CCOC2=NC=C(B3OC(C)(C)C(C)(C)O3)C=C2C(F)(F)F)CC1.CN1C=NC2=C(Cl)N=C(Cl)N=C21.O.O=C([O-])[O-].[Na+] </SMILES> Given the above reactants and reagents, what could be a probable product of their reaction?" }, { "role": "assistant", "content": "A probable product could be <SMILES> CN1C=NC2=C(C3=CN=C(OCCC4CCN(C(=O)OC(C)(C)C)CC4)C(C(F)(F)F)=C3)N=C(Cl)N=C21 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> CCCCC(C)(CC)C(=O)C1CCN2CCN(C)C(=O)N12 </SMILES> is the SMILES representation of a molecule. What is its IUPAC name?" }, { "role": "assistant", "content": "<IUPAC> (8S)-8-(2-ethyl-2-methylhexanoyl)-2-methyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazin-1-one </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Convert the following SMILES notation <SMILES> BrC1=CC=C(CC2(CC3=CC=C(Br)C=C3)OCCO2)C=C1 </SMILES> into its IUPAC nomenclature." }, { "role": "assistant", "content": "<IUPAC> 2,2-bis[(4-bromophenyl)methyl]-1,3-dioxolane </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you list the reactants that might result in the chemical product <SMILES> O=CC1=CC=C(CSC2=CC=C(O)C(Cl)=C2)C=C1 </SMILES> ?" }, { "role": "assistant", "content": "<SMILES> O=CC1=CC=C(CBr)C=C1.OC1=CC=C(S)C=C1Cl </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What reactants could lead to the production of the following product? <SMILES> CN1C([N+](=O)[O-])=CN=C1C1=NC(OCCNCCO)=C2C=CC=CC2=N1 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CN1C([N+](=O)[O-])=CN=C1C1=NC(Cl)=C2C=CC=CC2=N1.OCCNCCO </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Please identify the SMILES representation of the molecule named <IUPAC> N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[2-[4-[[(2S)-2,3-diaminopropanoyl]amino]phenyl]ethynyl]benzamide </IUPAC> ." }, { "role": "assistant", "content": "The molecule's SMILES representation is <SMILES> NCC(N)C(=O)NC1=CC=C(C#CC2=CC=C(C(=O)NC(C(=O)NO)C(N)O)C=C2)C=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What is the IUPAC name of the molecule <SMILES> CC=C(O)C(=CC)C1=C(F)C=CC(N)=C1O </SMILES> ?" }, { "role": "assistant", "content": "<IUPAC> 6-amino-3-fluoro-2-[(2Z,4E)-4-hydroxyhexa-2,4-dien-3-yl]phenol </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Consider that for a chemical reaction, if <SMILES> Br[Mg]C1=CC=CC=C1.CC(=O)C1=CC=CC=C1.CC(=O)O.CC(=O)OC(C)=O </SMILES> is/are the reactants and reagents, what can be the product?" }, { "role": "assistant", "content": "<SMILES> C=C(C1=CC=CC=C1)C1=CC=CC=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What reactants could lead to the production of the following product? <SMILES> CCCC1=C(CC2=CC=C(C3=CC=CC=C3C3=NOC(=O)N3)C=C2)C(=O)N([C@H]2CC[C@H](C3=NN=C(C)O3)CC2)C2=NC=NN12 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CCCC1=C(CC2=CC=C(C3=CC=CC=C3C#N)C=C2)C(=O)N([C@H]2CC[C@H](C3=NN=C(C)O3)CC2)C2=NC=NN12.O=C([O-])O.[NH3+]O </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Based on the given reactants and reagents: <SMILES> CC1=CC=C(S(=O)(=O)O)C=C1.CC1=CC=CC=C1.O=S(=O)(O)O </SMILES>, what product could potentially be produced?" }, { "role": "assistant", "content": "The product can be <SMILES> O=S1C=C2C=CCOC2=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "I'd like to know the molecular formula of <SMILES> COCC1=CC(C(=O)NC(CN)C2CC2)=NO1 </SMILES> . Can you tell me?" }, { "role": "assistant", "content": "Sure. It's <MOLFORMULA> C11H17N3O3 </MOLFORMULA> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Determine the IUPAC name for the molecule represented by the following SMILES representation: <SMILES> CN(C)CC(=O)NCCC1CCNCC1;Cl;Cl </SMILES> ." }, { "role": "assistant", "content": "<IUPAC> 2-(dimethylamino)-N-(2-piperidin-4-ylethyl)acetamide;dihydrochloride </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you identify the reactant(s) that might result in the given product <SMILES> CCOC(=O)C1=COC(N)=N1 </SMILES> ?" }, { "role": "assistant", "content": "<SMILES> CCOC(=O)C(=O)CBr.NC(N)=O </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you list the reactants that might result in the chemical product <SMILES> O=C1NC2=CC=C(F)C=C2C1=CC1=C2CCOC(=O)C2=CN1 </SMILES> ?" }, { "role": "assistant", "content": "<SMILES> O=C1CC2=CC(F)=CC=C2N1.O=CC1=C2CCOC(=O)C2=CN1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Do retrosynthesis with the product <SMILES> CC1=NC2=NC=C(C3=CC=C(F)C(C4=CC=CC=C4C#N)=C3)N2C=C1 </SMILES> ." }, { "role": "assistant", "content": "OK. The reactants may be <SMILES> CC1(C)OB(C2=CC=C(F)C(C3=CC=CC=C3C#N)=C2)OC1(C)C.CC1=NC2=NC=C(Br)N2C=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you tell me the potential product of a chemical reaction that uses <SMILES> C1COCCN1.COC(=O)C1=CC=CC(I)=C1.O=C1NC2=CC=CC=C2[C@@]12C[C@@H]2C1=CC=C(Cl)C=C1 </SMILES> as the reactants and reagents?" }, { "role": "assistant", "content": "Sure. A potential product: <SMILES> O=C(C1=CC=CC(N2C(=O)[C@]3(C[C@@H]3C3=CC=C(Cl)C=C3)C3=CC=CC=C32)=C1)N1CCOCC1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<IUPAC> methyl 4-[[(3-hydroxyoxolan-3-yl)methylamino]methyl]benzoate </IUPAC> is the IUPAC name of a molecule. Please give its molecular formula." }, { "role": "assistant", "content": "<MOLFORMULA> C14H19NO4 </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Convert the following SMILES notation <SMILES> NC1CCC(NC(=S)C23CC4CC(C5=CC=CC=C5)(CC2C4OC2=CC=CC=C2)C3)CC1 </SMILES> into its IUPAC nomenclature." }, { "role": "assistant", "content": "<IUPAC> N-(4-aminocyclohexyl)-6-phenoxy-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> CCOCC.ClCCl.O=C(C1=CC=CC=C1)C1=NOC(CSC2=CC=CC=C2)=N1.O=C(OO)C1=CC=CC(Cl)=C1.O=S([O-])([O-])=S.[Na+] </SMILES> Considering the given starting materials, what might be the resulting product in a chemical reaction?" }, { "role": "assistant", "content": "<SMILES> O=C(C1=CC=CC=C1)C1=NOC(CS(=O)C2=CC=CC=C2)=N1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Predict the product of a chemical reaction with <SMILES> BrC1=CN=C2C=CC=CC2=C1.CCOCC.COC1=CC(C=O)=CC=C1OCC1=CC=CC=C1.[Li]CCCC </SMILES> as the reactants and reagents." }, { "role": "assistant", "content": "<SMILES> COC1=CC(C(O)C2=CN=C3C=CC=CC3=C2)=CC=C1OCC1=CC=CC=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "With the given product <SMILES> CCCC1=CC(OC2=CC=CC=C2)=CC=C1OCCCOC1=CC=C(S(N)(=O)=O)C=C1 </SMILES>, suggest some likely reactants that were used in its synthesis." }, { "role": "assistant", "content": "<SMILES> CCCC1=CC(OC2=CC=CC=C2)=CC=C1OCCCBr.NS(=O)(=O)C1=CC=C(O)C=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> BrC1=CC=CC2=C1N[C@H]1CCNC[C@@H]21.C1CCOC1.CCOC(=O)Cl.O=C([O-])[C@@H](O)C1=CC=CC=C1.O=C([O-])[O-].[Na+] </SMILES> Considering the given starting materials, what might be the resulting product in a chemical reaction?" }, { "role": "assistant", "content": "<SMILES> CCOC(=O)N1CC[C@@H]2NC3=C(Br)C=CC=C3[C@@H]2C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Convert the IUPAC name of a molecule <IUPAC> 8-hydrazinyl-3-methyl-7-(2-phenylethyl)purine-2,6-dione </IUPAC> into SMILES representation." }, { "role": "assistant", "content": "<SMILES> CN1C(=O)NC(=O)C2=C1N=C(NN)N2CCC1=CC=CC=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Given the following reactants and reagents, please provide a possible product. <SMILES> CCCCC1=NN2C=CC=CC2=C1CC1=CC=C(C2=CC=CC=C2C(=O)OC(C)(C)C)C=C1.CCOCC.ClCCl.O=C(O)C(F)(F)F.[Na+].[OH-] </SMILES>" }, { "role": "assistant", "content": "<SMILES> CCCCC1=NN2C=CC=CC2=C1CC1=CC=C(C2=CC=CC=C2C(=O)O)C=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Predict the product of a chemical reaction with <SMILES> C1=CC=C([PH](C2=CC=CC=C2)(C2=CC=CC=C2)[Pd]([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)[PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1.COC1=CC=C(Br)C=C1C1=NC(C2=CC=CC=N2)=NO1.COCCOC.O=C([O-])[O-].OB(O)C1=CC=NC=C1.[Na+] </SMILES> as the reactants and reagents." }, { "role": "assistant", "content": "<SMILES> COC1=CC=C(C2=CC=NC=C2)C=C1C1=NC(C2=CC=CC=N2)=NO1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> CC(C)(C)OC(=O)COC1=CC=CC2=C1C1=C(C(N)=O)C=CC=C1N2CC1=CC=CC=C1Cl </SMILES> Given the product provided, propose some possible reactants that could have been employed in its formation." }, { "role": "assistant", "content": "Here are possible reactants: <SMILES> CC(C)(C)OC(=O)CBr.NC(=O)C1=CC=CC2=C1C1=C(O)C=CC=C1N2CC1=CC=CC=C1Cl </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Name the molecular formula for the molecule established as <IUPAC> amino-oxo-[(E)-2-(3,4,5-trimethylphenyl)ethenyl]azanium </IUPAC> using the IUPAC nomenclature." }, { "role": "assistant", "content": "<MOLFORMULA> C11H15N2O+ </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "For the molecule with <IUPAC> 2,5-diphenyldiazaphospholidine </IUPAC> as the IUPAC name, what is the corresponding SMILES representation?" }, { "role": "assistant", "content": "The corresponding SMILES representation is <SMILES> C1=CC=C(C2CPN(C3=CC=CC=C3)N2)C=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> CC(=O)C1=CC(C)=NC(C)=C1.CCOC(=O)C(O)(CC(=O)C1=CC(C)=NC(C)=C1)C(=O)OCC </SMILES> Given the above reactants and reagents, what could be a probable product of their reaction?" }, { "role": "assistant", "content": "A probable product could be <SMILES> CCOC(=O)C(O)(CC(=O)C1=CC=NC=C1)C(=O)OCC </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> CC1(C)CC2=CC=CC(N)=C2O1.ClC1=CC=C2C(I)=CC=CC2=N1.NCC1=CC=CN=C1 </SMILES> Given the above reactants and reagents, what could be a probable product of their reaction?" }, { "role": "assistant", "content": "A probable product could be <SMILES> CC1(C)CC2=CC=CC(NC3=CC=C4C(NCC5=CC=CN=C5)=CC=CC4=N3)=C2O1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Consider that for a chemical reaction, if <SMILES> ClC(Cl)Cl.NC(=O)/C=C(\\C(=O)O)C1=CC=C(N)C=C1.O=C1C=CC(=O)O1 </SMILES> is/are the reactants and reagents, what can be the product?" }, { "role": "assistant", "content": "<SMILES> NC(=O)/C=C(\\C(=O)O)C1=CC=C(C(=O)O)C=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Predict the product of a chemical reaction with <SMILES> CC(C)COC1=CC=CC2=C1C(OCC1CCNCC1)=NO2.COC(=O)C(C)(C)C=O.COC(=O)C1(C=O)CCC1 </SMILES> as the reactants and reagents." }, { "role": "assistant", "content": "<SMILES> COC(=O)C(C)(C)CN1CCC(COC2=NOC3=CC=CC(OCC(C)C)=C23)CC1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Provide the potential reactants that may be used to produce the product <SMILES> CC(=O)OCC1=C(C2=CN(C)C(=O)C(NC3=NN4CCN(C)CC4=C3)=C2)C=C(F)C=C1N1CCN2C(=CC3=C2CC(C)(C)C3)C1=O </SMILES> ." }, { "role": "assistant", "content": "The potential reactants: <SMILES> CC(=O)OCC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1N1CCN2C(=CC3=C2CC(C)(C)C3)C1=O.CN1CCN2N=C(NC3=CC(Br)=CN(C)C3=O)C=C2C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Provide the molecular formula for the IUPAC named substance <IUPAC> 2-[(3S)-1-(3-chloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]-3-methylimidazo[4,5-b]pyridine </IUPAC> ." }, { "role": "assistant", "content": "<MOLFORMULA> C18H19ClN4O2S </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Consider that for a chemical reaction, if <SMILES> C1CCOC1.CCN(C(C)C)C(C)C.CN1N=NC2=C(C#N)C=C(C3=CC=C(OCCCOS(C)(=O)=O)C(C(F)(F)F)=C3)C=C21.CNC </SMILES> is/are the reactants and reagents, what can be the product?" }, { "role": "assistant", "content": "<SMILES> CN(C)CCCOC1=CC=C(C2=CC3=C(N=NN3C)C(C#N)=N2)C=C1C(F)(F)F </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Consider that for a chemical reaction, if <SMILES> CC1=CC=CC=C1C1=CC(N2CCOCC2)=NC=C1C(N)=O.C[O-].Cl.ClCCl.O=C1CCC(=O)N1Br.[Na+] </SMILES> is/are the reactants and reagents, what can be the product?" }, { "role": "assistant", "content": "<SMILES> COC(=O)NC1=CN=C(N2CCOCC2)C=C1C1=CC=CC=C1C </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Consider that for a chemical reaction, if <SMILES> C1CCOC1.CO.COC(=O)C1=CC=C(C2=CN=CN2C)C=C1.O.[Li+].[OH-] </SMILES> is/are the reactants and reagents, what can be the product?" }, { "role": "assistant", "content": "<SMILES> CN1C=NC=C1C1=CC=C(C(=O)O)C=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What reactants could lead to the production of the following product? <SMILES> CS(=O)C1=CC=CC2=C(C3=CC=NC=N3)C(C3=CC=C(F)C=C3)=NN12 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CSC1=CC=CC2=C(C3=CC=NC=N3)C(C3=CC=C(F)C=C3)=NN12.O=C(OO)C1=CC=CC(Cl)=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> COC1=CC(C)=CC=C1C1=NC(C)=C(C2=CC=CN=C2)N1 </SMILES> Given the product provided, propose some possible reactants that could have been employed in its formation." }, { "role": "assistant", "content": "Here are possible reactants: <SMILES> COC1=CC(C)=CC=C1C1=NC(C)=C(C2=CC=CN=C2)N1O </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Could you tell which reactants might have been used to generate the following product? <SMILES> N#CC1=CC(Cl)=CC(OC2=C(Cl)C=CC(CNC(=O)C3=NNC=C3)=C2F)=C1 </SMILES>" }, { "role": "assistant", "content": "<SMILES> N#CC1=CC(Cl)=CC(OC2=C(Cl)C=CC(CN)=C2F)=C1.O=C(O)C1=NNC=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What is the molecular formula for the molecule denoted by <SMILES> O=C(C=CC1=CC=C(C2=CC=C(F)C=C2)S1)NCC(=O)NC1=CC=C(N2C=NC=N2)C=C1 </SMILES> ?" }, { "role": "assistant", "content": "<MOLFORMULA> C23H18FN5O2S </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Translate the chemical IUPAC name <IUPAC> N-(7-bicyclo[4.1.0]heptanyl)-2-fluoro-2-methylpropanamide </IUPAC> into its molecular formula." }, { "role": "assistant", "content": "<MOLFORMULA> C11H18FNO </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What is the IUPAC name of the molecule <SMILES> N#CC1=CC=C(C2=NC3=C(C4=CC=CC=C4)C=C4C(C5=CC=CC(C6=C(F)C(F)=C(F)C(F)=C6F)=C5)=NC5=CC=CC=C5C4=C3N=C2C2=CC=C(C#N)C=C2)C=C1 </SMILES> ?" }, { "role": "assistant", "content": "<IUPAC> 4-[2-(4-cyanophenyl)-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-5-phenylpyrazino[2,3-k]phenanthridin-3-yl]benzonitrile </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Predict a possible product from the listed reactants and reagents. <SMILES> CCCCC[C@H]1CC[C@H]([C@H]2CC[C@H](C(O)CC3=CC=C(F)C(F)=C3)CC2)CC1.CCN(CC)CC.CS(C)=O.ClCCl.O.O=C(Cl)C(=O)Cl </SMILES>" }, { "role": "assistant", "content": "<SMILES> CCCCC[C@H]1CC[C@H]([C@H]2CC[C@H](C(=O)CC3=CC=C(F)C(F)=C3)CC2)CC1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Convert the following SMILES notation <SMILES> CCCC(N)(CCC)C(N)(CCC)CCC </SMILES> into its IUPAC nomenclature." }, { "role": "assistant", "content": "<IUPAC> 4,5-dipropyloctane-4,5-diamine </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Do retrosynthesis with the product <SMILES> CC1=CC=C(NC(=O)C2=CC(N3CCN(C)CC3)=CC(S(F)(F)(F)(F)F)=C2)C=C1N1C=CN2N=C(C3=CC=CN=C3)C=C12 </SMILES> ." }, { "role": "assistant", "content": "OK. The reactants may be <SMILES> CC1=CC=C(N)C=C1N1C=CN2N=C(C3=CC=CN=C3)C=C12.CN1CCN(C2=CC(C(=O)O)=CC(S(F)(F)(F)(F)F)=C2)CC1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Based on the given reactants and reagents: <SMILES> NCC1=CC=C(Cl)N=C1.O=C(O)C1=CC([N+](=O)[O-])=C(SC2=C(Cl)C=NC=C2Cl)S1 </SMILES>, what product could potentially be produced?" }, { "role": "assistant", "content": "The product can be <SMILES> O=C(NCC1=CC=C(Cl)N=C1)C1=CC([N+](=O)[O-])=C(SC2=C(Cl)C=NC=C2Cl)S1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What is the molecular formula of the compound with this IUPAC name <IUPAC> 10-naphthalen-2-yl-2-phenylnaphtho[2,1-g][1,3]benzothiazole </IUPAC> ?" }, { "role": "assistant", "content": "<MOLFORMULA> C31H19NS </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "To synthesis <SMILES> O=C(O)C1=CC2=CC=C(Br)C=C2C2=CC=CC=C12 </SMILES>, what are the possible reactants? Write in the SMILES representation." }, { "role": "assistant", "content": "<SMILES> NC1=CC=CC=C1C(=CC1=CC=C(Br)C=C1)C(=O)[O-] </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you identify the reactant(s) that might result in the given product <SMILES> COC1=C(Cl)C(=O)N(C)N=C1 </SMILES> ?" }, { "role": "assistant", "content": "<SMILES> CN1N=CC(Cl)=C(Cl)C1=O.C[O-] </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Given the following reactants and reagents, please provide a possible product. <SMILES> CN(C)C=O.O=C([O-])[O-].O=CC1=CC([N+](=O)[O-])=CC=C1F.OC1=CC=CC=C1.[K+] </SMILES>" }, { "role": "assistant", "content": "<SMILES> O=CC1=CC([N+](=O)[O-])=CC=C1OC1=CC=CC=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Please provide a feasible product that could be formed using these reactants and reagents: <SMILES> C1=CC=C(P(C2=CC=CC=C2)[C-]2C=CC=C2)C=C1.C1CCOC1.CC#N.CC1(C)OBOC1(C)C.CCN(CC)CC.CCOC(C)=O.COC(=O)C1=NC(N2CCC3=CC=CC(C(=O)NC4=NC5=CC=CC=C5S4)=C3C2)=CC=C1Br.ClCCl.Cl[Pd]Cl.[Fe+2] </SMILES> ." }, { "role": "assistant", "content": "<SMILES> COC(=O)C1=NC(N2CCC3=CC=CC(C(=O)NC4=NC5=CC=CC=C5S4)=C3C2)=CC=C1B1OC(C)(C)C(C)(C)O1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "The IUPAC name of a certain molecule is <IUPAC> N-(3-chloro-4-fluorophenyl)-2-[(5R)-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide </IUPAC> . Can you provide its SMILES representation?" }, { "role": "assistant", "content": "The SMILES representation is <SMILES> CC1=CC(C)=CC(N=C2NC(=O)C(CC(=O)NC3=CC=C(F)C(Cl)=C3)S2)=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Translate the given SMILES formula of a molecule <SMILES> C1=CC=C(C2=NN=C(NCCC3=CN4CCCCC4=N3)S2)C=C1 </SMILES> into its IUPAC name." }, { "role": "assistant", "content": "<IUPAC> 5-phenyl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3,4-thiadiazol-2-amine </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Based on the given reactants and reagents: <SMILES> C1CCOC1.C=CCOC1=CC=C(C(=O)OC)C=C1.CO.[Na+].[OH-] </SMILES>, what product could potentially be produced?" }, { "role": "assistant", "content": "The product can be <SMILES> C=CCOC1=CC=C(C(=O)O)C=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Convert the following SMILES notation <SMILES> COC(=O)C1=C(C)OC(CN(C)C(=O)C2=CC=C(N3C=CN=C3)C=C2)=C1 </SMILES> into its IUPAC nomenclature." }, { "role": "assistant", "content": "<IUPAC> methyl 5-[[(4-imidazol-1-ylbenzoyl)-methylamino]methyl]-2-methylfuran-3-carboxylate </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you tell me the potential product of a chemical reaction that uses <SMILES> C=CC=CC(=O)OC.O=C1NNC(=O)C1(CCOC1CCCCO1)CC1=CC=CC=C1 </SMILES> as the reactants and reagents?" }, { "role": "assistant", "content": "Sure. A potential product: <SMILES> COC(=O)C1C=CCN2C(=O)C(CCOC3CCCCO3)(CC3=CC=CC=C3)C(=O)N12 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <SMILES> C[C@H](NC(=O)OC(C)(C)C)C(=O)NC1=CC=CC=C1NC1CCCOC1 </SMILES>" }, { "role": "assistant", "content": "<SMILES> C[C@H](NC(=O)OC(C)(C)C)C(=O)O.NC1=CC=CC=C1NC1CCCOC1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Predict a possible product from the listed reactants and reagents. <SMILES> CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1.CCN=C=NCCCN(C)C.CCO.CCOC(C)=O.CN(C)C=O.CNC.Cl.ClCCl.ON1N=NC2=CC=CN=C21 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CN(C)C(=O)C1CCN(C(=O)OC(C)(C)C)CC1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Propose a potential product given these reactants and reagents. <SMILES> CCOCC.CC[Si](CC)(CC)OC(C1=CC=C2C(=C1)C=CN2CC1=CC=CC=C1)(C(F)(F)F)C(F)(F)F.CN(C)C=O.O=C1CCC(=O)N1I.[Cl-].[NH4+] </SMILES>" }, { "role": "assistant", "content": "<SMILES> CC[Si](CC)(CC)OC(C1=CC=C2C(=C1)C(I)=CN2CC1=CC=CC=C1)(C(F)(F)F)C(F)(F)F </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<IUPAC> [(2S)-but-3-en-2-yl] 5-(difluoromethoxy)-1-methylpyrazole-3-carboxylate </IUPAC> The above is the IUPAC name of a molecule. Write its molecular formula." }, { "role": "assistant", "content": "<MOLFORMULA> C10H12F2N2O3 </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Given the following reactants and reagents, please provide a possible product. <SMILES> C1COCCO1.CCOP(=O)(CCOCCOCCOC[C@H](C)NC(=O)OC(C)(C)C)OCC </SMILES>" }, { "role": "assistant", "content": "<SMILES> CCOP(=O)(CCOCCOCCOC[C@H](C)N)OCC </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Turn the given SMILES symbol of a molecule <SMILES> CC(CN1C(=O)CCC1CCNCC1=CC=CN=C1)C1=CC=CC=C1 </SMILES> into its respective IUPAC name." }, { "role": "assistant", "content": "<IUPAC> (5R)-1-[(2S)-2-phenylpropyl]-5-[2-(pyridin-3-ylmethylamino)ethyl]pyrrolidin-2-one </IUPAC>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2i", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> C1CCOC1.CC(C)(O)C1=NN=C2[C@H](N)CC[C@@H](C3=CC=CC(F)=C3F)CN21.CCN(CC)CC.ClCCl.O=C(N1C=CN=C1)N1C=CN=C1.O=C1NCCC12CCNCC2 </SMILES> Considering the given starting materials, what might be the resulting product in a chemical reaction?" }, { "role": "assistant", "content": "<SMILES> CC(C)(O)C1=NN=C2[C@H](NC(=O)N3CCC4(CCNC4=O)CC3)CC[C@@H](C3=CC=CC(F)=C3F)CN21 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Identify possible reactants that could have been used to create the specified product. <SMILES> C=CCOC1=CC=C(C)C2=C1C(=O)C1CCCCC21 </SMILES>" }, { "role": "assistant", "content": "<SMILES> C=CCBr.CC1=CC=C(O)C2=C1C1CCCCC1C2=O </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What is the molecular formula for the molecule denoted by <SMILES> CNC1CCOCC1S(=O)C1=CC=CC(C(F)(F)F)=C1 </SMILES> ?" }, { "role": "assistant", "content": "<MOLFORMULA> C13H16F3NO2S </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Based on the given reactants and reagents: <SMILES> C1CCOC1.O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-].O=C1OC(=O)C2CC=CCC12.[Al+3].[H-].[K+].[Li+].[Na+] </SMILES>, what product could potentially be produced?" }, { "role": "assistant", "content": "The product can be <SMILES> OCC1CC=CCC1CO </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Provide the potential reactants that may be used to produce the product <SMILES> CC1=CC(Cl)=CC2=C1N1C(=NN=C1N1CCN(C)CC1)CN=C2C1=CC=CC=N1 </SMILES> ." }, { "role": "assistant", "content": "The potential reactants: <SMILES> CC1=CC(Cl)=CC2=C1N1C(Br)=NN=C1CN=C2C1=CC=CC=N1.CN1CCNCC1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you identify the reactant(s) that might result in the given product <SMILES> CCOC(=O)CNC(=O)C1=C(O)C2=CC(Cl)=CC(C)=C2SC1=O </SMILES> ?" }, { "role": "assistant", "content": "<SMILES> CCOC(=O)CNC(=O)C1=C(O)C2=CC(Cl)=CC(Br)=C2SC1=O.C[Sn](C)(C)C </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<SMILES> COC(=O)[C@@H]1C[C@H](N(CC(C)C)C(=O)C2=CN=C(C(C)(C)C)N=C2NCCCS(C)=O)CN(C(=O)OC(C)(C)C)C1 </SMILES> Given the product provided, propose some possible reactants that could have been employed in its formation." }, { "role": "assistant", "content": "Here are possible reactants: <SMILES> COC(=O)[C@@H]1C[C@H](N(CC(C)C)C(=O)C2=CN=C(C(C)(C)C)N=C2NCCCSC)CN(C(=O)OC(C)(C)C)C1.O=C(OO)C1=CC=CC(Cl)=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you give the SMILES notation of the molecule <IUPAC> N-(5-chloro-2-cyanophenyl)-2-(2-cyanophenoxy)acetamide </IUPAC> ?" }, { "role": "assistant", "content": "Sure. <SMILES> N#CC1=CC=C(Cl)C=C1NC(=O)COC1=CC=CC=C1C#N </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What reactants could lead to the production of the following product? <SMILES> CC(C)(C)C(=O)NCC1=CC=C(Cl)C(C(=O)NC2=CC(F)=C(F)C(C(=O)NC3=CC=C(Br)C=C3)=C2)=C1 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CC(C)(C)C(=O)NCC1=CC=C(Cl)C(C(=O)NC2=CC(F)=C(F)C(C(=O)O)=C2)=C1.NC1=CC=C(Br)C=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Convert the SMILES representation of a molecule <SMILES> CC1COCCN1C1=NC=CC2=C1N=CN2 </SMILES> into molecular formula." }, { "role": "assistant", "content": "<MOLFORMULA> C11H14N4O </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-s2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you tell me the potential product of a chemical reaction that uses <SMILES> CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1=NC=CC2=CC(N)=CC=C12.CC1=CC(B(O)O)=CC=C1CCOC(=O)NC1=CC=CC(C#N)=C1.O.O=CC(=O)O </SMILES> as the reactants and reagents?" }, { "role": "assistant", "content": "Sure. A potential product: <SMILES> CC1=CC(C(NC2=CC=C3C(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)=NC=CC3=C2)C(=O)O)=CC=C1CCOC(=O)NC1=CC=CC(C#N)=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <SMILES> CC1=C(C)C2=C(C3=CC(Br)=C(O[C@@H](CCC4=CC=CC=C4)C(=O)O)C(Br)=C3)C3=CC=CC=C3C(Br)=C2S1 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CC1=C(C)C2=C(C3=CC(Br)=C(O)C(Br)=C3)C3=CC=CC=C3C(Br)=C2S1.O=C([O-])[C@H](O)CCC1=CC=CC=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Provide the potential reactants that may be used to produce the product <SMILES> COC1=CC=CC=C1CN1C=CN=C1C(C)C1=CC=CC(C)=C1C </SMILES> ." }, { "role": "assistant", "content": "The potential reactants: <SMILES> CC1=CC=CC(C(C)C2=NC=CN2)=C1C.COC1=CC=CC=C1CBr </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "A chemical reaction has started with the substance(s) <SMILES> CCC1=CC=C(CCOC2=CC=C(CC3SC(=O)NC3=O)C=C2)N=C1.CCN(CC)CC.ClCCl.O.O=C(NCCO[N+](=O)[O-])OCCl </SMILES> as the reactants and reagents, what could be a probable product?" }, { "role": "assistant", "content": "A probable product: <SMILES> CCC1=CC=C(CCOC2=CC=C(CC3SC(=O)N(COC(=O)NCCO[N+](=O)[O-])C3=O)C=C2)N=C1 </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Build a molecule that meets the requirement: The molecule is a C-glycosyl compound that is isovitexin in which the hydroxyl hydrogen at position 7 is replaced by a beta-D-glucosyl residue. It has a role as a metabolite. It is a dihydroxyflavone, a glycosyloxyflavone, a monomethoxyflavone, a C-glycosyl compound and a monosaccharide derivative. It derives from an isoscoparin." }, { "role": "assistant", "content": "OK. <SMILES> COC1=CC(C2=CC(=O)C3=C(O)C([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3O2)=CC=C1O </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "molecule_generation", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Using <SMILES> CC(C)C[AlH]CC(C)C.CC1=CC=CC=C1.O=C1C[C@@H]2[C@@H](CC[C@H](CCC3=CC=CC=C3)OC3CCCCO3)[C@H](OC3CCCCO3)C[C@@H]2O1 </SMILES> as the reactants and reagents, tell me the potential product." }, { "role": "assistant", "content": "<SMILES> OC1C[C@@H]2[C@@H](CC[C@H](CCC3=CC=CC=C3)OC3CCCCO3)[C@H](OC3CCCCO3)C[C@@H]2O1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "<IUPAC> 1-(furan-2-ylmethyl)-3-[3-(1-methylpiperidin-4-yl)-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea </IUPAC> is the IUPAC name of a molecule. Please give its SMILES representation." }, { "role": "assistant", "content": "<SMILES> CN1CCC(C2=NN=C3C(NC(=O)NCC4=CC=CO4)=CC=CN23)CC1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2s", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "I need a molecule that meets the following conditions: The molecule is often attached to a R aglycon. Please represent the molecule in SMILES." }, { "role": "assistant", "content": "<SMILES> CC(=O)N[C@@H]1[C@@H](O)[C@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[C@]3(C(=O)O)C[C@H](O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)CO)O3)[C@H]2O)[C@@H](CO)O[C@H]1O </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "molecule_generation", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a tripeptide composed of L-tryptophan, L-alanine, and glycine joined by peptide linkages. It has a role as a metabolite. It derives from a L-alanine, a L-tryptophan and a glycine." }, { "role": "assistant", "content": "The SMILES representation of a molecule that follows your description: <SMILES> C[C@H](NC(=O)[C@@H](N)CC1=CNC2=CC=CC=C12)C(=O)NCC(=O)O </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "molecule_generation", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "For the molecule named <IUPAC> tert-butyl N-[4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]carbamate </IUPAC> by IUPAC nomenclature, provide its molecular formula." }, { "role": "assistant", "content": "<MOLFORMULA> C19H19F3N2O4 </MOLFORMULA>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "name_conversion-i2f", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "What reactants could lead to the production of the following product? <SMILES> CN1C=CC2=CC=CC(CNC3=CC=CC(C4=C5C=CC=C(Cl)C5=NN=C4C4=CC=CC=C4)=C3)=C21 </SMILES>" }, { "role": "assistant", "content": "<SMILES> CN1C=CC2=CC=CC(C=O)=C21.NC1=CC=CC(C2=C3C=CC=C(Cl)C3=NN=C2C2=CC=CC=C2)=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "retrosynthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Please give me some details about this molecule. <SMILES> C=C(C)[C@H]1CC[C@H](C)[C@@H](O)C1 </SMILES>" }, { "role": "assistant", "content": "The molecule is a dihydrocarveol with (1S,2S,4S)-stereochemistry. It has a role as a plant metabolite. It is an enantiomer of a (-)-dihydrocarveol." } ]
{ "source": "SMolInstruct", "split": "train", "task": "molecule_captioning", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Propose a potential product given these reactants and reagents. <SMILES> CC1=CC=C2NC3=CC=CC=C3C(=S)NC2=C1.CCCCO.COC(CN)OC </SMILES>" }, { "role": "assistant", "content": "<SMILES> COC(CNC1=NC2=CC(C)=CC=C2NC2=CC=CC=C12)OC </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Using <SMILES> CC(C)=O.CCO.COC(=O)C1CC(=O)N(CC2=CC=C(OC)C=C2)C1.[BH4-].[Cl-].[NH4+].[Na+] </SMILES> as the reactants and reagents, tell me the potential product." }, { "role": "assistant", "content": "<SMILES> COC1=CC=C(CN2CC(CO)CC2=O)C=C1 </SMILES>" } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
[ { "role": "user", "content": "Can you tell me the potential product of a chemical reaction that uses <SMILES> CC1=NC=CC=C1C#N.CN(C)C=O </SMILES> as the reactants and reagents?" }, { "role": "assistant", "content": "Sure. A potential product: <SMILES> CN(C)C=CC1=NC=CC=C1C#N </SMILES> ." } ]
{ "source": "SMolInstruct", "split": "train", "task": "forward_synthesis", "language": "en", "licence": "cc-by-4.0", "chemistry": true, "cid": null, "question_id": null, "answer_letter": null, "category": null, "seq_type": null, "smiles": null, "original_source": null, "id": null, "problem": null, "subject": null, "reference_answer": null }
End of preview. Expand in Data Studio
YAML Metadata Warning: empty or missing yaml metadata in repo card (https://huggingface.co/docs/hub/datasets-cards)
---
language: en
license: other
license_name: various
license_details: This dataset combines multiple source datasets with varying licenses. Users should review the original source datasets and their respective licenses.
tags:
  - chemistry
  - science
  - smi
  - molecules
  - instruction-tuning
  - sft
  - question-answering
  - text-generation
annotations_creators:
  - expert-generated
  - machine-generated
language_creators:
  - found
language_details: en-US
pretty_name: Chemistry SFT Ultra
size_categories:
  - 1M<n<10M
source_datasets:
  - smolininstruct
  - omnichem
  - moleculeqa
  - chemrxiv
  - tulu-3-sft-mixture
  - numinamath-cot
  - textbookreasoning
task_categories:
  - question-answering
  - text-generation
task_ids:
  - extractive-qa
  - open-domain-qa
  - text2text-generation
configs:
  - config_name: default
    data_files:
      - split: train
        path: chemistry_mix.parquet
    dataset_info:
      features:
        - name: messages
          list:
            - name: role
              dtype: string
            - name: content
              dtype: string
        - name: metadata
          struct:
            - name: source
              dtype: string
            - name: split
              dtype: string
            - name: task
              dtype: string
            - name: language
              dtype: string
            - name: licence
              dtype: string
            - name: chemistry
              dtype: bool
    splits:
      - name: train
        num_examples: 1370322
        num_bytes: 0
    download_size: 0
    dataset_size: 0
---

# Chemistry SFT Ultra

Modern chemistry fine-tuning data built from seven rigorously curated open datasets, merged into a single English-only corpus with reproducible processing and analysis.

## Dataset Summary

This repository curates seven open-source instruction and QA datasets into a single, cleaned, deduplicated, English-only training corpus. Each source is processed by purpose-built scripts, validated structurally, and profiled with quantitative heuristics and chemistry-specific quality checks (RDKit).

The final corpus contains **1,370,322 rows** with:
- Deterministic processing and validation
- **Very low duplication** (≈0.00% estimated)
- Strong **chemistry signal** (SMILES detection) and **RDKit validity** (≈99.72% parse/canon on a 200k sample after light salvage)
- Balanced **source/task composition** (entropy metrics)

## Source Datasets

| Dataset | Target Rows | Actual Rows |
| --- | ---: | ---: |
| SMolInstruct | 440 000 | 440 000 |
| OmniChem | 199 000 | 199 000 |
| MoleculeQA | 60 000 | 60 000 |
| ChemRxiv-Train | 137 635 | 137 635 |
| Tulu-3 SFT Mixture | 370 000 | 370 000 |
| NuminaMath-CoT | 170 000 | 170 000 |
| TextbookReasoning | 97 000 | 97 000 |
| **Merged Chemistry Mix** |  | **1,370,322** |

Row totals reflect post-filtering counts and final merge deduplication + language filtering (English probability  0.98).

## Dataset Structure

Each example contains:
- `messages`: A list of message dictionaries with `role` and `content` keys
- `metadata`: A dictionary with source information including:
  - `source`: Original dataset name
  - `split`: Dataset split (typically "train")
  - `task`: Task type (e.g., "retrosynthesis", "property_prediction", etc.)
  - `language`: Language code (en)
  - `licence`: License information
  - `chemistry`: Boolean flag indicating chemistry content

### Data Fields

```python
{
    "messages": [
        {"role": "user", "content": "..."},
        {"role": "assistant", "content": "..."}
    ],
    "metadata": {
        "source": "SMolInstruct",
        "split": "train",
        "task": "retrosynthesis",
        "language": "en",
        "licence": "MIT",
        "chemistry": True
    }
}

Dataset Analysis

Latest Metrics

chemistry_mix:
  Rows: 1,370,322
  Turns -> min 2, max 294, avg 2.06, >2 turns 0.75%
  Empty rows: 0 | SMILES-detected rows: 507,712
  LexDiv: 0.8066 (unique toks: 2,270,292)
  Exact dup pairs: 0 | unique pairs: 1,370,322
  Source entropy: 2.561 | Task entropy: 3.354
  RDKit: parse=99.72%, canon=100.00%, scaffold_div=0.44, |charge|≥3=0.00% (salvage 199431/200000)
  Near-dup est.: 0.00% on 300,000 rows

Interpretation: The final corpus is largely QA (few multi-turn threads), heavy on real chemistry content (≈37% rows with detected SMILES), very low duplication, and high RDKit validity after light salvage (replacing salts/whitespace variants).

Task Distribution

The dataset contains a extensive set of chemistry-related tasks including:

  • Retrosynthesis and forward synthesis
  • Property prediction (ESOL, Lipophilicity, HIV, etc.)
  • Molecule generation and captioning
  • Name conversion (SMILES ↔ IUPAC ↔ Formula)
  • Chemistry QA and multiple choice questions
  • Math chain-of-thought reasoning
  • Instruction following
  • Retrieval QA

Processing Pipeline

All datasets were processed through a rigorous pipeline:

  1. Normalization: Converting each source to a canonical format
  2. Quality filtering: Removing empty or invalid examples
  3. Language filtering: Ensuring English-only content (probability ≥ 0.98)
  4. Deduplication: Removing exact duplicates based on (user, assistant) hash
  5. Validation: Automated consistency checks
  6. Chemistry validation: RDKit-based SMILES validation and salvage

Usage

from datasets import load_dataset

# Load the dataset
dataset = load_dataset("your-username/chemistry-sft-ultra", split="train")

# Access examples
example = dataset[0]
messages = example["messages"]
metadata = example["metadata"]

# Filter for chemistry examples
chemistry_examples = dataset.filter(lambda x: x["metadata"]["chemistry"])

# Filter by task
retrosynthesis_examples = dataset.filter(lambda x: x["metadata"]["task"] == "retrosynthesis")

Considerations for Use

  • The dataset is primarily English-language chemistry content
  • Approximately 37% of examples contain SMILES strings
  • Very low duplication rate (≈0.00%)
  • High RDKit validity (≈99.72% parse success rate)
  • Balanced source and task distribution

License

This dataset combines multiple source datasets with varying licenses. Users should review the original source datasets and their respective licenses. The processing and curation work is released under the same terms as the source materials.

Citation

If you use this dataset in your research, please cite:

@dataset{chemistry_sft_ultra,
  title={Chemistry SFT Ultra: A Curated Chemistry Instruction Tuning Dataset},
  author={Your Name},
  year={2024},
  url={https://huggingface.co/datasets/your-username/chemistry-sft-ultra}
}
Downloads last month
19